CymitQuimica logo

CAS 1261946-57-9

:

6-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:
6-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a fluorine atom and a methoxycarbonyl group. This compound features both acidic and aromatic properties, making it potentially useful in various chemical reactions and applications. The presence of the fluorine atom can enhance the compound's reactivity and influence its biological activity, while the methoxycarbonyl group may contribute to its solubility and stability. The carboxylic acid functional group is indicative of its potential to participate in acid-base reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Additionally, its specific CAS number allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-20-14(19)8-2-4-11(15)10(6-8)12-5-3-9(7-16-12)13(17)18/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=GTNWDTJDCYGHKY-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C(OC)=O)=CC1)C2=CC=C(C(O)=O)C=N2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-[2-fluoro-5-(methoxycarbonyl)phenyl]-
  • 6-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.