CAS 1261946-60-4

3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-ol

Description:

3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of chlorine and fluorine substituents on the biphenyl framework significantly influences its chemical properties and reactivity. Specifically, the dichloro groups at the 3′ and 5′ positions and the fluoro group at the 2 position contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. The hydroxyl (-OH) group at the 4 position enhances its polarity and solubility in polar solvents, which can affect its biological activity and interaction with other molecules. This compound may exhibit interesting properties such as antimicrobial or herbicidal activity, making it of interest in research and development. Additionally, its molecular structure suggests potential for further derivatization, which could lead to the synthesis of novel compounds with tailored functionalities. Safety and handling precautions should be observed due to the presence of halogenated substituents, which may pose environmental and health risks.

Formula: C₁₂H₇Cl₂FO

InChI: InChI=1S/C12H7Cl2FO/c13-8-3-7(4-9(14)5-8)11-2-1-10(16)6-12(11)15/h1-6,16H

InChI key: InChIKey=IUYQWQVHTXWTOY-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(O)=C1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 3′,5′-dichloro-2-fluoro-
• 3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-ol