CAS 1261946-87-5

Ethyl 3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate

Description:

Ethyl 3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate, identified by its CAS number 1261946-87-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a hydroxy group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The ethyl ester functional group at the carboxylate position enhances its lipophilicity, making it more soluble in organic solvents. This compound may exhibit biological activity due to the presence of the hydroxy and fluoro substituents, which can influence its interaction with biological targets. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reactive species.

Formula: C₁₅H₁₃FO₃

InChI: InChI=1S/C15H13FO3/c1-2-19-15(18)11-5-3-10(4-6-11)12-7-8-14(17)13(16)9-12/h3-9,17H,2H2,1H3

InChI key: InChIKey=KLHZXRFHYPDYJM-UHFFFAOYSA-N

SMILES: FC=1C=C(C2=CC=C(C(OCC)=O)C=C2)C=CC1O

Synonyms:

• Ethyl 3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 3′-fluoro-4′-hydroxy-, ethyl ester