
CAS 1261947-27-6
:5-(5-Formyl-2-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Description:
5-(5-Formyl-2-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thienyl group, and a carboxylic acid functional group. This compound features a formyl group attached to the thienyl moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the dihydro and keto functionalities indicates that it may exhibit tautomeric behavior, which can influence its chemical properties and interactions. The carboxylic acid group suggests that it can participate in acid-base reactions, making it a potential candidate for various chemical transformations. Additionally, the compound may possess biological activity, which could be explored in medicinal chemistry. Its unique structural features may also allow for interesting interactions with other molecules, making it a subject of interest in research related to drug development and materials science. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields.
Formula:C11H7NO4S
InChI:InChI=1S/C11H7NO4S/c13-5-7-1-2-9(17-7)8-3-6(11(15)16)4-12-10(8)14/h1-5H,(H,12,14)(H,15,16)
InChI key:InChIKey=VUPFFOMFRMSFNJ-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C=2SC(C=O)=CC2
Synonyms:- 5-(5-Formyl-2-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-(5-formyl-2-thienyl)-1,6-dihydro-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.