CAS 1261947-30-1

5-Benzo[b]thien-2-yl-2-methylphenol

Description:

5-Benzo[b]thien-2-yl-2-methylphenol is an organic compound characterized by its unique structure, which includes a benzo[b]thienyl group and a methylphenol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group in the phenol structure suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the compound may display biological activity, which is often a focus in medicinal chemistry. Its molecular structure can lead to interesting electronic properties, making it a candidate for studies in organic electronics or as a dye. The compound's stability, reactivity, and potential interactions with other substances can be influenced by factors such as pH and solvent polarity. Overall, 5-Benzo[b]thien-2-yl-2-methylphenol represents a complex chemical entity with diverse potential applications, warranting further investigation into its properties and uses.

Formula: C₁₅H₁₂OS

InChI: InChI=1S/C15H12OS/c1-10-6-7-12(8-13(10)16)15-9-11-4-2-3-5-14(11)17-15/h2-9,16H,1H3

InChI key: InChIKey=ALUYVYWFXSXLJJ-UHFFFAOYSA-N

SMILES: OC=1C=C(C2=CC=3C(S2)=CC=CC3)C=CC1C

Synonyms:

• 5-Benzo[b]thien-2-yl-2-methylphenol
• Phenol, 5-benzo[b]thien-2-yl-2-methyl-