
CAS 1261947-43-6
:3′-Bromo-5′-hydroxy[1,1′-biphenyl]-4-methanol
Description:
3′-Bromo-5′-hydroxy[1,1′-biphenyl]-4-methanol, identified by its CAS number 1261947-43-6, is an organic compound characterized by the presence of a biphenyl structure with specific functional groups. This compound features a bromine atom at the 3′ position and a hydroxyl group at the 5′ position of the biphenyl moiety, along with a methanol group at the 4 position. The presence of these substituents contributes to its potential reactivity and solubility properties. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. The hydroxyl group can participate in hydrogen bonding, influencing the compound's physical properties such as melting point and solubility in polar solvents. Additionally, the bromine substituent can serve as a site for further chemical modifications, enhancing the compound's utility in synthetic applications. Overall, the unique structural features of 3′-Bromo-5′-hydroxy[1,1′-biphenyl]-4-methanol suggest a versatile compound with potential applications in various fields of chemistry.
Formula:C13H11BrO2
InChI:InChI=1S/C13H11BrO2/c14-12-5-11(6-13(16)7-12)10-3-1-9(8-15)2-4-10/h1-7,15-16H,8H2
InChI key:InChIKey=JKWLOABPBQAOFH-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(O)C1)C2=CC=C(CO)C=C2
Synonyms:- 3′-Bromo-5′-hydroxy[1,1′-biphenyl]-4-methanol
- [1,1′-Biphenyl]-4-methanol, 3′-bromo-5′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.