CAS 1261947-75-4

2-Amino-5-[4-(methylsulfonyl)phenyl]-4-pyridinecarboxylic acid

Description:

2-Amino-5-[4-(methylsulfonyl)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261947-75-4, is a chemical compound characterized by its complex structure that includes a pyridine ring, an amino group, and a carboxylic acid functional group. This compound features a methylsulfonyl group attached to a phenyl ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid and amino groups. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its functional groups. Additionally, the presence of the methylsulfonyl moiety can enhance the compound's pharmacokinetic properties. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a significant interest in research and development within the field of organic and medicinal chemistry.

Formula: C₁₃H₁₂N₂O₄S

InChI: InChI=1S/C13H12N2O4S/c1-20(18,19)9-4-2-8(3-5-9)11-7-15-12(14)6-10(11)13(16)17/h2-7H,1H3,(H2,14,15)(H,16,17)

InChI key: InChIKey=LLXLAZBYMDYIJL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(N)C1)C2=CC=C(S(C)(=O)=O)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-amino-5-[4-(methylsulfonyl)phenyl]-
• 2-Amino-5-[4-(methylsulfonyl)phenyl]-4-pyridinecarboxylic acid