CAS 1261947-81-2

4-Methyl[1,1′-biphenyl]-3,4′-diol

Description:

4-Methyl[1,1′-biphenyl]-3,4′-diol, identified by its CAS number 1261947-81-2, is an organic compound characterized by its biphenyl structure with hydroxyl groups and a methyl substituent. This compound features two phenyl rings connected by a single bond, with hydroxyl (-OH) groups positioned at the 3 and 4' positions of one of the rings, and a methyl (-CH3) group at the 4 position of the other ring. The presence of hydroxyl groups contributes to its potential solubility in polar solvents and may influence its reactivity, making it a candidate for various chemical reactions, including those involving hydrogen bonding. The compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall molecular structure. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₃H₁₂O₂

InChI: InChI=1S/C13H12O2/c1-9-2-3-11(8-13(9)15)10-4-6-12(14)7-5-10/h2-8,14-15H,1H3

InChI key: InChIKey=IFOYGZGJNMJLIX-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1C)C2=CC=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-diol, 4-methyl-
• 4-Methyl[1,1′-biphenyl]-3,4′-diol