CAS 1261947-82-3

3-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-2-carboxylic acid

Description:

3-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The hydroxymethyl group (-CH2OH) contributes to its potential for hydrogen bonding, enhancing its solubility in polar solvents. The fluorine atom at the 3-position of the biphenyl ring introduces electronegativity, which can influence the compound's reactivity and polarity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its unique combination of functional groups may allow for various synthetic modifications, expanding its utility in chemical applications. Overall, 3-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-2-carboxylic acid presents a diverse profile of chemical properties that can be explored in both academic and industrial settings.

Formula: C₁₄H₁₁FO₃

InChI: InChI=1S/C14H11FO3/c15-12-7-3-6-11(13(12)14(17)18)10-5-2-1-4-9(10)8-16/h1-7,16H,8H2,(H,17,18)

InChI key: InChIKey=YZKRQJXWKJCLPE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1F)C2=C(CO)C=CC=C2

Synonyms:

• 3-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 3-fluoro-2′-(hydroxymethyl)-