CymitQuimica logo

CAS 1261947-94-7

:

2′-(Hydroxymethyl)-5-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-(Hydroxymethyl)-5-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxymethyl group (-CH2OH) and a methoxy group (-OCH3) attached to the biphenyl framework, along with a carboxylic acid group (-COOH) that contributes to its acidity and reactivity. The presence of these functional groups suggests that the compound may exhibit polar characteristics, making it soluble in polar solvents. Its structural features may also impart specific biological activities, potentially making it of interest in pharmaceutical research. The compound's molecular interactions could be influenced by the spatial arrangement of its substituents, affecting its overall chemical behavior. Additionally, the presence of the carboxylic acid group indicates that it can participate in acid-base reactions, while the methoxy group may influence its electronic properties and steric hindrance. Overall, this compound's unique structure and functional groups contribute to its potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H14O4
InChI:InChI=1S/C15H14O4/c1-19-13-7-11(6-12(8-13)15(17)18)14-5-3-2-4-10(14)9-16/h2-8,16H,9H2,1H3,(H,17,18)
InChI key:InChIKey=NPCWVFQFYGRLCV-UHFFFAOYSA-N
SMILES:C(O)C1=C(C2=CC(C(O)=O)=CC(OC)=C2)C=CC=C1
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-(hydroxymethyl)-5-methoxy-
  • 2′-(Hydroxymethyl)-5-methoxy[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.