CAS 1261948-33-7

4′-Chloro-3′-cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid

Description:

4′-Chloro-3′-cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its complex biphenyl structure, which features multiple functional groups that contribute to its chemical properties. The presence of a chloro group, a cyano group, and a nitro group on the biphenyl framework enhances its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. This compound is likely to exhibit polar characteristics due to the presence of electronegative atoms, which can influence its solubility in different solvents. Additionally, the nitro and cyano groups can impart significant electronic effects, making it a candidate for use in materials science, pharmaceuticals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and cyano compounds.

Formula: C₁₄H₇ClN₂O₄

InChI: InChI=1S/C14H7ClN2O4/c15-12-4-2-8(5-10(12)7-16)9-1-3-11(14(18)19)13(6-9)17(20)21/h1-6H,(H,18,19)

InChI key: InChIKey=PBALDONZKJKAAI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC(C#N)=C(Cl)C=C2

Synonyms:

• 4′-Chloro-3′-cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 4′-chloro-3′-cyano-3-nitro-