CAS 1261948-70-2

2-Chloro-5-(3-cyano-2-fluorophenyl)-3-pyridinecarboxylic acid

Description:

2-Chloro-5-(3-cyano-2-fluorophenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and multiple substituents such as a chloro group and a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The cyano and chloro substituents can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The fluorine atom may enhance lipophilicity and metabolic stability. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of compounds with specific biological activities. Its unique combination of functional groups may also contribute to its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Overall, this compound represents a versatile structure with various implications in chemical research and application.

Formula: C₁₃H₆ClFN₂O₂

InChI: InChI=1S/C13H6ClFN2O2/c14-12-10(13(18)19)4-8(6-17-12)9-3-1-2-7(5-16)11(9)15/h1-4,6H,(H,18,19)

InChI key: InChIKey=GVSWNBGNBLHTOO-UHFFFAOYSA-N

SMILES: FC1=C(C=2C=C(C(O)=O)C(Cl)=NC2)C=CC=C1C#N

Synonyms:

• 3-Pyridinecarboxylic acid, 2-chloro-5-(3-cyano-2-fluorophenyl)-
• 2-Chloro-5-(3-cyano-2-fluorophenyl)-3-pyridinecarboxylic acid