CAS 1261949-49-8

6′-Chloro-5-(trifluoromethoxy)[1,1′-biphenyl]-3,3′-diol

Description:

6′-Chloro-5-(trifluoromethoxy)[1,1′-biphenyl]-3,3′-diol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 6′ position and a trifluoromethoxy group at the 5 position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound also features hydroxyl groups at the 3 and 3′ positions, which can participate in hydrogen bonding and may influence its solubility and reactivity. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its specific interactions with biological targets and environmental behavior would depend on its structural attributes and functional groups. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity in any practical applications.

Formula: C₁₃H₈ClF₃O₃

InChI: InChI=1S/C13H8ClF3O3/c14-12-2-1-8(18)6-11(12)7-3-9(19)5-10(4-7)20-13(15,16)17/h1-6,18-19H

InChI key: InChIKey=ZKZOSIORWZCERU-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(OC(F)(F)F)=CC(O)=C2)C=C(O)C=C1

Synonyms:

• 6′-Chloro-5-(trifluoromethoxy)[1,1′-biphenyl]-3,3′-diol
• [1,1′-Biphenyl]-3,3′-diol, 6′-chloro-5-(trifluoromethoxy)-