CymitQuimica logo

CAS 1261949-72-7

:

5′-Fluoro-2′-hydroxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:
5′-Fluoro-2′-hydroxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which features a fluorine atom, a hydroxyl group, and a nitro group attached to the biphenyl framework. The presence of these functional groups contributes to its potential reactivity and solubility properties. The fluorine atom typically enhances the compound's lipophilicity, while the hydroxyl group can engage in hydrogen bonding, influencing its solubility in polar solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's overall electronic characteristics and reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features that could lead to specific biological activities or applications in organic synthesis. Its CAS number, 1261949-72-7, allows for precise identification and retrieval of information regarding its properties, safety data, and potential uses in research and industry.
Formula:C13H8FNO5
InChI:InChI=1S/C13H8FNO5/c14-9-1-2-12(16)11(6-9)7-3-8(13(17)18)5-10(4-7)15(19)20/h1-6,16H,(H,17,18)
InChI key:InChIKey=PODDJXLGESXACF-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC(C(O)=O)=CC(N(=O)=O)=C2)C=C(F)C=C1
Synonyms:
  • 5′-Fluoro-2′-hydroxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5′-fluoro-2′-hydroxy-5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.