
CAS 1261949-98-7
:3-(4-Chloro-2-methylphenyl)-4-pyridinecarboxylic acid
Description:
3-(4-Chloro-2-methylphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261949-98-7, is an organic compound characterized by its complex structure that includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methyl group on the phenyl ring contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while its aromatic characteristics may provide stability and facilitate interactions with other organic molecules. The compound may also demonstrate biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including as an intermediate in the production of agrochemicals or pharmaceuticals. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H10ClNO2
InChI:InChI=1S/C13H10ClNO2/c1-8-6-9(14)2-3-10(8)12-7-15-5-4-11(12)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=MFWLVPCHNKHHGF-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=C(C)C=C(Cl)C=C2
Synonyms:- 3-(4-Chloro-2-methylphenyl)-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 3-(4-chloro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.