CymitQuimica logo

CAS 1261950-16-6

:

3-(2,4,6-Trifluorophenyl)-4-pyridinecarboxylic acid

Description:
3-(2,4,6-Trifluorophenyl)-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine and trifluorophenyl functional groups. This compound features a pyridine ring substituted with a carboxylic acid group at the 4-position and a 2,4,6-trifluorophenyl group at the 3-position. The presence of the trifluoromethyl groups significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for various applications in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Additionally, the trifluoromethyl substituents can enhance metabolic stability and influence the compound's overall pharmacokinetics. Overall, 3-(2,4,6-Trifluorophenyl)-4-pyridinecarboxylic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H6F3NO2
InChI:InChI=1S/C12H6F3NO2/c13-6-3-9(14)11(10(15)4-6)8-5-16-2-1-7(8)12(17)18/h1-5H,(H,17,18)
InChI key:InChIKey=XKMAGBVSSAOVLY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=C(F)C=C(F)C=C2F
Synonyms:
  • 4-Pyridinecarboxylic acid, 3-(2,4,6-trifluorophenyl)-
  • 3-(2,4,6-Trifluorophenyl)-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.