CAS 1261950-17-7

3′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxaldehyde

Description:

3′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3' and 4' positions on one of the phenyl rings contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions with other molecules. The hydroxyl group (-OH) at the 2-position and the aldehyde group (-CHO) at the 3-position further define its chemical behavior, making it a versatile compound for various applications in organic synthesis and medicinal chemistry. The compound's functional groups suggest it may participate in hydrogen bonding and exhibit polar characteristics, which can affect its solubility in different solvents. Additionally, the fluorine substituents can impart stability and alter the compound's lipophilicity, making it of interest in the development of pharmaceuticals and agrochemicals. Overall, this compound's structural features suggest potential utility in research and industrial applications.

Formula: C₁₃H₈F₂O₂

InChI: InChI=1S/C13H8F2O2/c14-11-5-4-8(6-12(11)15)10-3-1-2-9(7-16)13(10)17/h1-7,17H

InChI key: InChIKey=VLMVEJBYDQFJJT-UHFFFAOYSA-N

SMILES: OC1=C(C=CC=C1C=O)C2=CC(F)=C(F)C=C2

Synonyms:

• 3′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxaldehyde
• [1,1′-Biphenyl]-3-carboxaldehyde, 3′,4′-difluoro-2-hydroxy-