CAS 1261950-35-9

2-Amino-5-[4-(1,1-dimethylethyl)phenyl]-4-pyridinecarboxylic acid

Description:

2-Amino-5-[4-(1,1-dimethylethyl)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261950-35-9, is a chemical compound characterized by its complex structure, which includes an amino group, a pyridine ring, and a carboxylic acid functional group. This compound features a tert-butyl group attached to a phenyl ring, contributing to its hydrophobic characteristics. The presence of the amino and carboxylic acid groups indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. Its pyridine moiety suggests that it may exhibit basic properties, allowing it to act as a ligand in coordination chemistry. The compound's structure may also influence its biological activity, making it of interest in pharmaceutical research. Overall, its unique combination of functional groups and structural features may provide diverse applications in medicinal chemistry and material science.

Formula: C₁₆H₁₈N₂O₂

InChI: InChI=1S/C16H18N2O2/c1-16(2,3)11-6-4-10(5-7-11)13-9-18-14(17)8-12(13)15(19)20/h4-9H,1-3H3,(H2,17,18)(H,19,20)

InChI key: InChIKey=GQJGUCIIVBIKQJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(N)C1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-amino-5-[4-(1,1-dimethylethyl)phenyl]-
• 2-Amino-5-[4-(1,1-dimethylethyl)phenyl]-4-pyridinecarboxylic acid