CymitQuimica logo

CAS 1261951-50-1

:

5-[4-(1-Piperidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:
5-[4-(1-Piperidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid, with the CAS number 1261951-50-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential solubility in polar solvents. The presence of the piperidinylcarbonyl group suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which can influence its reactivity and stability. Additionally, the aromatic phenyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound may be explored for various applications, particularly in drug development, due to its unique structural features and functional groups that can interact with biological systems.
Formula:C18H18N2O3
InChI:InChI=1S/C18H18N2O3/c21-17(20-8-2-1-3-9-20)14-6-4-13(5-7-14)15-10-16(18(22)23)12-19-11-15/h4-7,10-12H,1-3,8-9H2,(H,22,23)
InChI key:InChIKey=FKLRFBNRBQVYKU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C2=CC=C(C(=O)N3CCCCC3)C=C2
Synonyms:
  • 5-[4-(1-Piperidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-[4-(1-piperidinylcarbonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.