
CAS 1261951-55-6
:3′-Bromo-2-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile
Description:
3′-Bromo-2-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a bromine atom, a fluorine atom, a hydroxyl group, and a cyano group. The presence of these functional groups contributes to its unique chemical properties, such as potential reactivity and solubility characteristics. The bromine and fluorine substituents can influence the compound's electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. The hydroxyl group may impart hydrogen bonding capabilities, while the cyano group can enhance the compound's polarity and reactivity. This compound's specific interactions and stability can be influenced by its molecular geometry and the steric effects of the substituents. Overall, 3′-Bromo-2-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile represents a versatile structure that may be explored for various synthetic and functional applications in organic chemistry.
Formula:C13H7BrFNO
InChI:InChI=1S/C13H7BrFNO/c14-10-4-9(5-11(17)6-10)12-3-1-2-8(7-16)13(12)15/h1-6,17H
InChI key:InChIKey=REPCIXQTIXCNKC-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(Br)=CC(O)=C2)C=CC=C1C#N
Synonyms:- 3′-Bromo-2-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile
- [1,1′-Biphenyl]-3-carbonitrile, 3′-bromo-2-fluoro-5′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.