
CAS 1261951-82-9
:5-Bromo-3′-chloro-5′-methyl[1,1′-biphenyl]-3-ol
Description:
5-Bromo-3′-chloro-5′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of bromine and chlorine substituents, along with a hydroxyl group (-OH) and a methyl group (-CH3), contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The halogen substituents can also affect the compound's reactivity, potentially making it a candidate for electrophilic aromatic substitution reactions. Additionally, the presence of multiple functional groups suggests that it may have applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and temperature. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C13H10BrClO
InChI:InChI=1S/C13H10BrClO/c1-8-2-9(5-12(15)3-8)10-4-11(14)7-13(16)6-10/h2-7,16H,1H3
InChI key:InChIKey=HOHYGSSMWYAQNV-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(O)C1)C2=CC(C)=CC(Cl)=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-bromo-3′-chloro-5′-methyl-
- 5-Bromo-3′-chloro-5′-methyl[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.