
CAS 1261952-22-0
:3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-carboxaldehyde
Description:
3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3′ position and a trifluoromethoxy group (-O-CF3) at the 5′ position contributes to its unique chemical properties, including increased polarity and potential for hydrogen bonding. The aldehyde functional group (-CHO) at the 2-position enhances its reactivity, making it suitable for various chemical transformations. This compound may exhibit interesting biological activities due to its structural features, and its trifluoromethoxy group can influence its lipophilicity and metabolic stability. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's interaction with biological targets. Overall, this compound's distinctive functional groups and structural characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C14H9F3O3
InChI:InChI=1S/C14H9F3O3/c15-14(16,17)20-12-6-10(5-11(19)7-12)13-4-2-1-3-9(13)8-18/h1-8,19H
InChI key:InChIKey=IWCIJKQYEICPNB-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)C2=CC(OC(F)(F)F)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-2-carboxaldehyde, 3′-hydroxy-5′-(trifluoromethoxy)-
- 3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.