
CAS 1261952-54-8
:2′,3′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile
Description:
2′,3′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2' and 3' positions of the biphenyl moiety contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The hydroxyl group at the 4-position introduces polarity, which can influence hydrogen bonding and solvation behavior. Additionally, the carbonitrile functional group at the 3-position adds to the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and electrophilic substitutions. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and material science. Its specific applications and behavior would depend on the context of use, including its interactions with other chemical species and its stability under different conditions.
Formula:C13H7F2NO
InChI:InChI=1S/C13H7F2NO/c14-11-3-1-2-10(13(11)15)8-4-5-12(17)9(6-8)7-16/h1-6,17H
InChI key:InChIKey=QORPANKWXGKDGP-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C2=CC(C#N)=C(O)C=C2
Synonyms:- 2′,3′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile
- [1,1′-Biphenyl]-3-carbonitrile, 2′,3′-difluoro-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.