
CAS 1261952-90-2
:[3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-yl]-1-pyrrolidinylmethanone
Description:
The chemical substance known as [3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-yl]-1-pyrrolidinylmethanone, with the CAS number 1261952-90-2, is characterized by its complex molecular structure, which includes a biphenyl core substituted with a hydroxy group and a trifluoromethoxy group. This compound features a pyrrolidinylmethanone moiety, indicating the presence of a pyrrolidine ring attached to a carbonyl group. The trifluoromethoxy group contributes to the compound's unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The hydroxy group may also play a role in hydrogen bonding interactions, influencing the compound's biological activity and stability. Such structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of fluorine atoms typically enhances lipophilicity, which can affect the pharmacokinetics of the compound. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, making it of interest for further research and development.
Formula:C18H16F3NO3
InChI:InChI=1S/C18H16F3NO3/c19-18(20,21)25-16-10-14(9-15(23)11-16)12-4-3-5-13(8-12)17(24)22-6-1-2-7-22/h3-5,8-11,23H,1-2,6-7H2
InChI key:InChIKey=CUFMNVBSRSBFIC-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C=CC1)C2=CC(OC(F)(F)F)=CC(O)=C2)N3CCCC3
Synonyms:- Methanone, [3′-hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-yl]-1-pyrrolidinyl-
- [3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-yl]-1-pyrrolidinylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.