CymitQuimica logo

CAS 1261953-03-0

:

3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 3′ position and a nitro group at the 5 position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carboxylic acid functional group at the 3 position enhances its acidity and solubility in polar solvents. This compound may exhibit various reactivity patterns typical of substituted aromatic compounds, including electrophilic aromatic substitution and nucleophilic reactions due to the electron-withdrawing nature of the nitro group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent environment. As with many nitro-substituted compounds, it may also exhibit distinct spectroscopic characteristics, making it identifiable through techniques like NMR and IR spectroscopy.
Formula:C14H11NO4
InChI:InChI=1S/C14H11NO4/c1-9-3-2-4-10(5-9)11-6-12(14(16)17)8-13(7-11)15(18)19/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=FRYFCZOBPJEQJY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC(C)=CC=C2
Synonyms:
  • 3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-methyl-5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.