
CAS 1261953-05-2
:[3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-yl]-1-piperidinylmethanone
Description:
[3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-yl]-1-piperidinylmethanone, identified by its CAS number 1261953-05-2, is a synthetic organic compound characterized by its complex structure, which includes a biphenyl moiety, a hydroxyl group, and a trifluoromethoxy substituent. This compound features a piperidinylmethanone group, contributing to its potential biological activity. The presence of the trifluoromethoxy group enhances lipophilicity and may influence the compound's interaction with biological targets. The hydroxyl group can participate in hydrogen bonding, which may affect solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The unique combination of functional groups suggests that it may exhibit interesting chemical behavior, including potential activity as an inhibitor or modulator in various biochemical pathways. Overall, this compound represents a class of molecules that could be valuable in drug discovery and development, although specific biological activities would require further investigation.
Formula:C19H18F3NO3
InChI:InChI=1S/C19H18F3NO3/c20-19(21,22)26-17-11-15(10-16(24)12-17)13-4-6-14(7-5-13)18(25)23-8-2-1-3-9-23/h4-7,10-12,24H,1-3,8-9H2
InChI key:InChIKey=SPMQYNFIAGYAIP-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC=C(C(=O)N3CCCCC3)C=C2
Synonyms:- Methanone, [3′-hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-yl]-1-piperidinyl-
- [3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-yl]-1-piperidinylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.