CAS 1261953-36-9

6-(3-Aminophenyl)-3-pyridinecarboxylic acid

Description:

6-(3-Aminophenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261953-36-9, is an organic compound characterized by the presence of both a pyridine and an amino group within its structure. This compound features a pyridine ring substituted with a carboxylic acid group and an amino group attached to a phenyl ring, which contributes to its potential biological activity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the amino group can engage in hydrogen bonding, influencing the compound's solubility and reactivity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its structural features may also allow for various synthetic modifications, making it a versatile building block in organic synthesis. Overall, 6-(3-Aminophenyl)-3-pyridinecarboxylic acid is a compound of interest in both research and potential therapeutic applications.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c13-10-3-1-2-8(6-10)11-5-4-9(7-14-11)12(15)16/h1-7H,13H2,(H,15,16)

InChI key: InChIKey=HPJIKZZGWCQRHT-UHFFFAOYSA-N

SMILES: NC=1C=C(C2=CC=C(C(O)=O)C=N2)C=CC1

Synonyms:

• 6-(3-Aminophenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-(3-aminophenyl)-