CAS 1261954-43-1

5-(4-Chlorophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:

5-(4-Chlorophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with a 4-chlorophenyl group. This compound features a dihydro-2-oxo moiety, indicating the presence of a carbonyl group adjacent to the pyridine ring, contributing to its reactivity and potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its interaction with biological systems. The presence of the chlorine atom on the phenyl ring can affect the compound's electronic properties, potentially enhancing its lipophilicity and altering its pharmacokinetic profile. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including its synthesis, stability, and interactions with biological targets. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₈ClNO₃

InChI: InChI=1S/C12H8ClNO3/c13-8-3-1-7(2-4-8)10-6-14-11(15)5-9(10)12(16)17/h1-6H,(H,14,15)(H,16,17)

InChI key: InChIKey=UVOFSJDWVKREQM-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC=C(Cl)C=C2

Synonyms:

• 5-(4-Chlorophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 5-(4-chlorophenyl)-1,2-dihydro-2-oxo-