
CAS 1261954-82-8
:Methyl 3-fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-4-carboxylate
Description:
Methyl 3-fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-4-carboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH₃) and a hydroxy group (-OH) on the biphenyl framework contributes to its potential as a versatile building block in organic synthesis. The fluorine atom at the 3-position enhances the compound's reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The carboxylate group (-COOCH₃) indicates that the compound is an ester, which can affect its solubility and stability. This compound may exhibit unique properties due to the combination of functional groups, including potential antioxidant or antimicrobial activities. Its specific applications would depend on further studies, including its interaction with biological systems and its behavior under various chemical conditions. Overall, Methyl 3-fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-4-carboxylate represents a complex organic molecule with potential utility in various fields of research.
Formula:C15H13FO4
InChI:InChI=1S/C15H13FO4/c1-19-14-8-10(4-6-13(14)17)9-3-5-11(12(16)7-9)15(18)20-2/h3-8,17H,1-2H3
InChI key:InChIKey=BIJOFQOASWITCW-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1O)C2=CC(F)=C(C(OC)=O)C=C2
Synonyms:- Methyl 3-fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-4-carboxylate
- [1,1′-Biphenyl]-4-carboxylic acid, 3-fluoro-4′-hydroxy-3′-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.