CAS 1261955-00-3

2-Chloro-5-(3-thienyl)-3-pyridinecarboxylic acid

Description:

2-Chloro-5-(3-thienyl)-3-pyridinecarboxylic acid is a heterocyclic compound characterized by the presence of both a pyridine and a thiophene ring in its structure. The compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The chlorine substituent at the 2-position of the pyridine ring introduces electronegativity, influencing the compound's electronic properties and reactivity. The thienyl group, attached at the 5-position, adds to the compound's aromatic character and can participate in various chemical interactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can be influenced by the presence of the chlorine atom and the carboxylic acid group, which can engage in hydrogen bonding. Overall, 2-Chloro-5-(3-thienyl)-3-pyridinecarboxylic acid is a complex molecule with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.

Formula: C₁₀H₆ClNO₂S

InChI: InChI=1S/C10H6ClNO2S/c11-9-8(10(13)14)3-7(4-12-9)6-1-2-15-5-6/h1-5H,(H,13,14)

InChI key: InChIKey=FGWUNJRCOJEOBD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1Cl)C=2C=CSC2

Synonyms:

• 2-Chloro-5-(3-thienyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-chloro-5-(3-thienyl)-