CAS 1261955-01-4

3′-Methyl 4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate

Description:

3′-Methyl 4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of methyl and methoxy substituents on the biphenyl framework contributes to its unique chemical properties, including potential variations in solubility and reactivity. The dicarboxylate functional groups indicate that the compound contains two carboxylate moieties, which can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, the presence of electron-donating groups like methoxy can influence the electronic properties of the molecule, potentially affecting its interaction with biological targets. Overall, 3′-Methyl 4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate is a complex organic molecule with diverse applications in chemical research and potential implications in pharmaceuticals.

Formula: C₁₆H₁₄O₅

InChI: InChI=1S/C16H14O5/c1-20-12-6-7-13(14(9-12)15(17)18)10-4-3-5-11(8-10)16(19)21-2/h3-9H,1-2H3,(H,17,18)

InChI key: InChIKey=PQWJEFGRDMFZDF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(OC)=C1)C2=CC(C(OC)=O)=CC=C2

Synonyms:

• 3′-Methyl 4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate
• [1,1′-Biphenyl]-2,3′-dicarboxylic acid, 4-methoxy-, 3′-methyl ester