CAS 1261955-24-1

5-(3-Formylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:

5-(3-Formylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a formylphenyl group. This compound features a dihydro-6-oxo moiety, indicating the presence of a ketone functional group, and a carboxylic acid group, which contributes to its acidity and potential reactivity. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation or oxidation. The compound's structure may allow for interactions with biological systems, making it of interest in medicinal chemistry. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is placed. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₃H₉NO₄

InChI: InChI=1S/C13H9NO4/c15-7-8-2-1-3-9(4-8)11-5-10(13(17)18)6-14-12(11)16/h1-7H,(H,14,16)(H,17,18)

InChI key: InChIKey=NMUVZPBBQMWKLR-UHFFFAOYSA-N

SMILES: O=C1C(=CC(C(O)=O)=CN1)C2=CC(C=O)=CC=C2

Synonyms:

• 5-(3-Formylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(3-formylphenyl)-1,6-dihydro-6-oxo-