CAS 1261955-43-4

2-Hydroxy-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

2-Hydroxy-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including a hydroxyl group (-OH), two methoxy groups (-OCH3), and a carboxylic acid group (-COOH), contributing to its chemical reactivity and potential biological activity. The presence of the hydroxyl and carboxylic acid groups suggests that it may exhibit acidic properties, while the methoxy groups can influence its solubility and polarity. The compound's structure allows for potential hydrogen bonding, which can affect its interactions in biological systems. Additionally, the methoxy substituents may enhance lipophilicity, impacting its pharmacokinetics if studied for medicinal applications. Overall, this compound's unique structural features make it of interest in various fields, including organic synthesis and medicinal chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₅H₁₄O₅

InChI: InChI=1S/C15H14O5/c1-19-11-5-10(6-12(8-11)20-2)13-4-3-9(15(17)18)7-14(13)16/h3-8,16H,1-2H3,(H,17,18)

InChI key: InChIKey=KRMAHNKZQKAINW-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(OC)=CC(OC)=C2)C=CC(C(O)=O)=C1

Synonyms:

• 2-Hydroxy-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2-hydroxy-3′,5′-dimethoxy-