CAS 1261955-64-9

3-Chloro-4′-(ethylthio)[1,1′-biphenyl]-2-carboxylic acid

Description:

3-Chloro-4′-(ethylthio)[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The chlorine atom at the 3-position and the ethylthio group at the 4′-position introduce specific electronic and steric effects, influencing the compound's reactivity and solubility. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₅H₁₃ClO₂S

InChI: InChI=1S/C15H13ClO2S/c1-2-19-11-8-6-10(7-9-11)12-4-3-5-13(16)14(12)15(17)18/h3-9H,2H2,1H3,(H,17,18)

InChI key: InChIKey=YGIPHTUZUQXMBC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1Cl)C2=CC=C(SCC)C=C2

Synonyms:

• 3-Chloro-4′-(ethylthio)[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 3-chloro-4′-(ethylthio)-