CAS 1261955-72-9

2-Chloro-5-[5-(methoxycarbonyl)-3-thienyl]-4-pyridinecarboxylic acid

Description:

2-Chloro-5-[5-(methoxycarbonyl)-3-thienyl]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thienyl group, and a carboxylic acid functional group. The presence of the chloro substituent at the 2-position and the methoxycarbonyl group at the 5-position of the thienyl ring contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, the thienyl and pyridine moieties may impart specific electronic properties, making it a candidate for various biological activities. The compound's structural features suggest potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many such compounds, safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₂H₈ClNO₄S

InChI: InChI=1S/C12H8ClNO4S/c1-18-12(17)9-2-6(5-19-9)8-4-14-10(13)3-7(8)11(15)16/h2-5H,1H3,(H,15,16)

InChI key: InChIKey=HSADBLGIQRCIFS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(Cl)C1)C=2C=C(C(OC)=O)SC2

Synonyms:

• 2-Chloro-5-[5-(methoxycarbonyl)-3-thienyl]-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-chloro-5-[5-(methoxycarbonyl)-3-thienyl]-