CAS 1261956-00-6

2-(3-Chloro-4-methoxyphenyl)-4-pyridinecarboxylic acid

Description:

2-(3-Chloro-4-methoxyphenyl)-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methoxy group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. The carboxylic acid group can participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored in drug discovery research. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c1-18-12-3-2-8(6-10(12)14)11-7-9(13(16)17)4-5-15-11/h2-7H,1H3,(H,16,17)

InChI key: InChIKey=OJIHQWODVDMBTM-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1OC)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(3-chloro-4-methoxyphenyl)-
• 2-(3-Chloro-4-methoxyphenyl)-4-pyridinecarboxylic acid