CymitQuimica logo

CAS 1261956-34-6

:

3′,4-Difluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid

Description:
3′,4-Difluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid is an organic compound characterized by the presence of two fluorine atoms and two carboxylic acid functional groups attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with fluorine substituents located at the 3' and 4' positions of one of the rings. The carboxylic acid groups are located at the 3 and 4 positions of the other ring, contributing to its acidity and potential reactivity. The presence of fluorine atoms typically enhances the compound's stability and alters its electronic properties, making it of interest in various chemical applications, including materials science and pharmaceuticals. Additionally, the dicarboxylic acid functionality allows for potential interactions in polymerization processes or as a building block in organic synthesis. Overall, this compound's unique structure and functional groups make it a subject of interest for research in organic chemistry and related fields.
Formula:C14H8F2O4
InChI:InChI=1S/C14H8F2O4/c15-11-4-2-7(5-10(11)14(19)20)8-1-3-9(13(17)18)12(16)6-8/h1-6H,(H,17,18)(H,19,20)
InChI key:InChIKey=OIWAYUCBIWGOAN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1F)C2=CC(F)=C(C(O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′,4-difluoro-
  • 3′,4-Difluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.