
CAS 1261956-41-5
:4-Chloro-3′-ethoxy[1,1′-biphenyl]-3-ol
Description:
4-Chloro-3′-ethoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 4-position and an ethoxy group at the 3′-position contributes to its unique chemical properties. The hydroxyl (-OH) group at the 3-position enhances its polarity, making it more soluble in polar solvents. This compound may exhibit various biological activities due to its structural features, potentially influencing its interactions with biological systems. Its molecular structure suggests that it could participate in hydrogen bonding, which may affect its reactivity and stability. Additionally, the presence of halogen and ether functionalities can influence its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Overall, 4-Chloro-3′-ethoxy[1,1′-biphenyl]-3-ol is a compound of interest in both synthetic organic chemistry and potential pharmaceutical applications, warranting further investigation into its properties and uses.
Formula:C14H13ClO2
InChI:InChI=1S/C14H13ClO2/c1-2-17-12-5-3-4-10(8-12)11-6-7-13(15)14(16)9-11/h3-9,16H,2H2,1H3
InChI key:InChIKey=PLXWDTUNURNRAL-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1Cl)C2=CC(OCC)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 4-chloro-3′-ethoxy-
- 4-Chloro-3′-ethoxy[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.