CAS 1261956-48-2

3-Chloro-3′-(methylthio)[1,1′-biphenyl]-4-ol

Description:

3-Chloro-3′-(methylthio)[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the para position relative to the biphenyl linkage contributes to its potential as a phenolic compound, influencing its reactivity and solubility in various solvents. The chlorine atom and the methylthio group (-S-CH3) introduce additional functional characteristics, affecting the compound's electronic properties and steric hindrance. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry or agrochemicals. Its molecular structure suggests potential applications in synthesis or as an intermediate in chemical reactions. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as temperature and pH. Safety data should be consulted for handling and usage, as halogenated compounds can pose health and environmental risks.

Formula: C₁₃H₁₁ClOS

InChI: InChI=1S/C13H11ClOS/c1-16-11-4-2-3-9(7-11)10-5-6-13(15)12(14)8-10/h2-8,15H,1H3

InChI key: InChIKey=QQPFBKFKCDGOID-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1O)C2=CC(SC)=CC=C2

Synonyms:

• 3-Chloro-3′-(methylthio)[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 3-chloro-3′-(methylthio)-