
CAS 1261956-54-0
:4-(2,3-Dimethylphenyl)-2(1H)-pyridinone
Description:
4-(2,3-Dimethylphenyl)-2(1H)-pyridinone, identified by its CAS number 1261956-54-0, is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridinone moiety. The dimethylphenyl substituent contributes to its hydrophobic characteristics, influencing its solubility and reactivity. It may display various functional properties, such as acting as a ligand in coordination chemistry or exhibiting potential pharmacological effects, making it of interest in medicinal chemistry. The compound's stability, reactivity, and interactions with other molecules can be influenced by its electronic structure and steric factors arising from the dimethyl groups. Overall, 4-(2,3-Dimethylphenyl)-2(1H)-pyridinone represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-9-4-3-5-12(10(9)2)11-6-7-14-13(15)8-11/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=FEKUGIOQFAVPDI-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(=O)NC=C2)C=CC=C1C
Synonyms:- 2(1H)-Pyridinone, 4-(2,3-dimethylphenyl)-
- 4-(2,3-Dimethylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.