CymitQuimica logo

CAS 1261956-85-7

:

3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid

Description:
3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including two carboxylic acid groups (-COOH) at the 3 and 5 positions, a hydroxyl group (-OH) at the 4' position, and a chlorine atom (-Cl) at the 3' position of the biphenyl moiety. These functional groups contribute to its chemical reactivity and potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science. The presence of the chlorine atom may enhance the compound's biological activity or alter its solubility properties. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing the compound's physical properties, such as melting point and solubility in polar solvents. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and development in synthetic chemistry and related applications.
Formula:C14H9ClO5
InChI:InChI=1S/C14H9ClO5/c15-11-6-7(1-2-12(11)16)8-3-9(13(17)18)5-10(4-8)14(19)20/h1-6,16H,(H,17,18)(H,19,20)
InChI key:InChIKey=OFAWZTHNQQIVPZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(C(O)=O)C1)C2=CC(Cl)=C(O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3,5-dicarboxylic acid, 3′-chloro-4′-hydroxy-
  • 3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.