CAS 1261956-89-1

5-Bromo[1,1′-biphenyl]-3,4′-diol

Description:

5-Bromo[1,1′-biphenyl]-3,4′-diol is an organic compound characterized by the presence of a biphenyl structure substituted with a bromine atom and two hydroxyl (–OH) groups. The bromine atom is located at the 5-position of the biphenyl moiety, while the hydroxyl groups are positioned at the 3 and 4′ positions, contributing to the compound's potential as a phenolic compound. This structure imparts specific chemical properties, including the ability to participate in hydrogen bonding due to the hydroxyl groups, which can enhance solubility in polar solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its reactivity can be influenced by the presence of the bromine substituent, which can participate in electrophilic aromatic substitution reactions. Additionally, the compound's physical properties, such as melting point and solubility, would depend on its molecular interactions and the steric effects of the substituents. Overall, 5-Bromo[1,1′-biphenyl]-3,4′-diol is a versatile compound with potential applications in various chemical fields.

Formula: C₁₂H₉BrO₂

InChI: InChI=1S/C12H9BrO2/c13-10-5-9(6-12(15)7-10)8-1-3-11(14)4-2-8/h1-7,14-15H

InChI key: InChIKey=UKXYKVZENKLOBL-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=C(O)C1)C2=CC=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-diol, 5-bromo-
• 3-Bromo-5-(4-hydroxyphenyl)phenol
• 5-Bromo[1,1′-biphenyl]-3,4′-diol

3-Bromo-5-(4-hydroxyphenyl)phenol

CAS: 1261956-89-1

Formula: C₁₂H₉BrO₂

Molecular weight: 265.1027

Ref: IN-DA009WX9