
CAS 1261957-36-1
:Methyl 2-chloro-4-(1,2-dihydro-2-oxo-4-pyridinyl)benzoate
Description:
Methyl 2-chloro-4-(1,2-dihydro-2-oxo-4-pyridinyl)benzoate is a chemical compound characterized by its complex structure, which includes a benzoate moiety and a pyridine derivative. This compound features a chloro substituent at the 2-position of the benzoate ring and a 1,2-dihydro-2-oxo-pyridine group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro group can influence its reactivity and interaction with other chemical species. Methyl 2-chloro-4-(1,2-dihydro-2-oxo-4-pyridinyl)benzoate may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological properties. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a unique combination of functional groups that may be explored for various applications in research and industry.
Formula:C13H10ClNO3
InChI:InChI=1S/C13H10ClNO3/c1-18-13(17)10-3-2-8(6-11(10)14)9-4-5-15-12(16)7-9/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=KIWGSFFCZKZHKN-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C(OC)=O)C2=CC(=O)NC=C2
Synonyms:- Methyl 2-chloro-4-(1,2-dihydro-2-oxo-4-pyridinyl)benzoate
- Benzoic acid, 2-chloro-4-(1,2-dihydro-2-oxo-4-pyridinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.