
CAS 1261957-48-5
:3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-ol
Description:
3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethoxy group (-OCH2CH3) at the 3′ position and a nitro group (-NO2) at the 3 position of one of the phenyl rings contributes to its chemical reactivity and physical properties. The hydroxyl group (-OH) at the 4 position enhances its polarity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its functional groups, making it a candidate for various applications in pharmaceuticals or agrochemicals. Its molecular structure suggests potential for hydrogen bonding, influencing its melting and boiling points. Additionally, the nitro group can participate in electrophilic substitution reactions, while the ethoxy group may affect the compound's lipophilicity. Overall, 3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-ol is a complex molecule with diverse chemical properties that warrant further investigation for practical applications.
Formula:C14H13NO4
InChI:InChI=1S/C14H13NO4/c1-2-19-12-5-3-4-10(8-12)11-6-7-14(16)13(9-11)15(17)18/h3-9,16H,2H2,1H3
InChI key:InChIKey=MHEIOXMLBPPDKH-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C(C=CC1)C2=CC(N(=O)=O)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-ol, 3′-ethoxy-3-nitro-
- 3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.