
CAS 1261957-64-5
:2-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
Description:
2-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group with both fluorine and trifluoromethyl substituents. This compound is notable for its potential applications in pharmaceuticals and agrochemicals, owing to the presence of the carboxylic acid functional group, which can participate in various chemical reactions and interactions. The fluorine atoms contribute to the compound's lipophilicity and metabolic stability, making it an interesting candidate for drug development. Additionally, the trifluoromethyl group is known to enhance the biological activity of compounds, often improving their efficacy. The presence of these functional groups also influences the compound's solubility, boiling point, and reactivity. As with many fluorinated compounds, it may exhibit unique properties such as increased resistance to degradation and altered interaction with biological systems. Overall, this compound represents a significant area of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C13H7F4NO2
InChI:InChI=1S/C13H7F4NO2/c14-10-7(3-1-5-9(10)13(15,16)17)11-8(12(19)20)4-2-6-18-11/h1-6H,(H,19,20)
InChI key:InChIKey=RCPKZTDSABBYLX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=C(F)C(C(F)(F)F)=CC=C2
Synonyms:- 2-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[2-fluoro-3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.