CymitQuimica logo

CAS 1261957-72-5

:

6-Fluoro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:
6-Fluoro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 6-position, a hydroxy group at the 4′-position, and a nitro group at the 3′-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and allows for potential interactions in biological systems. This compound may exhibit interesting biological activities due to its functional groups, which can participate in hydrogen bonding and electron-withdrawing effects. Additionally, the presence of multiple substituents can influence its electronic properties, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential toxicity should be evaluated in the context of its intended use.
Formula:C13H8FNO5
InChI:InChI=1S/C13H8FNO5/c14-10-3-1-8(13(17)18)5-9(10)7-2-4-12(16)11(6-7)15(19)20/h1-6,16H,(H,17,18)
InChI key:InChIKey=CWKZJSXPUDNNOD-UHFFFAOYSA-N
SMILES:FC=1C(C2=CC(N(=O)=O)=C(O)C=C2)=CC(C(O)=O)=CC1
Synonyms:
  • 6-Fluoro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 6-fluoro-4′-hydroxy-3′-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.