CAS 1261957-92-9
:4′-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol
Description:
4′-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of one of the phenyl rings, contributing to its classification as a phenolic compound. Additionally, it has a methoxy group (-OCH₃) at the 3′ position and a fluorine atom at the 4′ position of the other phenyl ring, which can influence its chemical reactivity and biological activity. The presence of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. The molecular structure indicates that it may exhibit interesting properties such as solubility in organic solvents and potential interactions with biological systems, making it a subject of interest in medicinal chemistry and materials science. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c1-16-13-8-10(5-6-12(13)14)9-3-2-4-11(15)7-9/h2-8,15H,1H3
InChI key:InChIKey=HOYODJWNWJVBCN-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1F)C2=CC(O)=CC=C2
Synonyms:- 4′-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 4′-fluoro-3′-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
