CAS 1261957-94-1

5-[2-Chloro-5-(methoxycarbonyl)phenyl]-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:

5-[2-Chloro-5-(methoxycarbonyl)phenyl]-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of a chloro substituent and a methoxycarbonyl group on the phenyl ring contributes to its reactivity and potential applications in medicinal chemistry. The dihydro-2-oxo structure indicates that it may exhibit keto-enol tautomerism, which can influence its biological activity. This compound may be of interest in the development of pharmaceuticals due to its potential interactions with biological targets. Its solubility, stability, and reactivity can vary based on the pH and solvent conditions, making it important to consider these factors in experimental settings. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.

Formula: C₁₄H₁₀ClNO₅

InChI: InChI=1S/C14H10ClNO5/c1-21-14(20)7-2-3-11(15)8(4-7)10-6-16-12(17)5-9(10)13(18)19/h2-6H,1H3,(H,16,17)(H,18,19)

InChI key: InChIKey=MPJMEYWPUDNTEN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(C(OC)=O)=CC=C2Cl

Synonyms:

• 5-[2-Chloro-5-(methoxycarbonyl)phenyl]-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 5-[2-chloro-5-(methoxycarbonyl)phenyl]-1,2-dihydro-2-oxo-