CymitQuimica logo

CAS 1261958-09-1

:

2-Methoxy-5-[3-(1-pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:
2-Methoxy-5-[3-(1-pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a phenyl group substituted with a pyrrolidinylcarbonyl moiety. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the methoxy group may enhance lipophilicity, while the pyrrolidinylcarbonyl group could contribute to its biological activity, potentially making it a candidate for pharmaceutical applications. The compound's molecular structure suggests it may interact with biological targets, possibly influencing neurotransmitter systems or other pathways. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed computational analysis for precise determination. Overall, this compound represents a class of organic molecules with potential utility in medicinal chemistry and drug development.
Formula:C18H18N2O4
InChI:InChI=1S/C18H18N2O4/c1-24-16-15(18(22)23)10-14(11-19-16)12-5-4-6-13(9-12)17(21)20-7-2-3-8-20/h4-6,9-11H,2-3,7-8H2,1H3,(H,22,23)
InChI key:InChIKey=PBAIJKKPPKEQJX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC(C(=O)N3CCCC3)=CC=C2
Synonyms:
  • 2-Methoxy-5-[3-(1-pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-methoxy-5-[3-(1-pyrrolidinylcarbonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.