CAS 1261958-41-1

4-(5-Formyl-2-thienyl)-3-pyridinecarboxylic acid

Description:

4-(5-Formyl-2-thienyl)-3-pyridinecarboxylic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the formyl group on the thienyl ring suggests potential reactivity, particularly in condensation reactions or as a precursor for further functionalization. The compound's molecular structure indicates it may exhibit interesting electronic properties due to the conjugation between the aromatic systems of the pyridine and thienyl rings. Additionally, the presence of heteroatoms (nitrogen and sulfur) in the rings can influence its solubility and interaction with biological systems, making it a candidate for various applications in pharmaceuticals or materials science. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a fascinating area of study within organic chemistry and materials science.

Formula: C₁₁H₇NO₃S

InChI: InChI=1S/C11H7NO3S/c13-6-7-1-2-10(16-7)8-3-4-12-5-9(8)11(14)15/h1-6H,(H,14,15)

InChI key: InChIKey=XWONJTLHCIXTPU-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CC=NC1)C=2SC(C=O)=CC2

Synonyms:

• 3-Pyridinecarboxylic acid, 4-(5-formyl-2-thienyl)-
• 4-(5-Formyl-2-thienyl)-3-pyridinecarboxylic acid